CAS 1245643-21-3 appears in our catalog under these names: 7-Bromo-4,4-dimethyl-1h-benzo[d][1,3]oxazin-2(4h)-one, 95%, 7-Bromo-4,4-dimethyl-1H-benzo[d][1,3]oxazin-2(4H)-one, 98%, 98%, 7-Bromo-4,4-dimethyl-1H-benzo[d][1,3]oxazin-2(4H)-one, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 10g, 5g.
7-bromo-4,4-dimethyl-1H-3,1-benzoxazin-2-one (CAS 1245643-21-3) is a chemical compound with the molecular formula C10H10BrNO2 and a molecular weight of 256.10 g/mol. IUPAC name: 7-bromo-4,4-dimethyl-1H-3,1-benzoxazin-2-one. InChIKey: STVSVQWHHDPUEX-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO2 |
|---|---|
| Molecular weight | 256.10 g/mol |
| IUPAC name | 7-bromo-4,4-dimethyl-1H-3,1-benzoxazin-2-one |
| InChIKey | STVSVQWHHDPUEX-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=C(C=C2)Br)NC(=O)O1)C |
Computed by PubChem (NCBI)