Products 1260640-00-3
CAS 1260640-00-3 appears in our catalog under these names: 7-Bromo-1,2,3,4-tetrahydro-isoquinoline-1-carboxylic acid, 95%, 7-Bromo-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g, 100mg.
7-bromo-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid (CAS 1260640-00-3) is a chemical compound with the molecular formula C10H10BrNO2 and a molecular weight of 256.10 g/mol. IUPAC name: 7-bromo-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid. InChIKey: NCUGWXAJTCNZBN-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO2 |
|---|---|
| Molecular weight | 256.10 g/mol |
| IUPAC name | 7-bromo-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid |
| InChIKey | NCUGWXAJTCNZBN-UHFFFAOYSA-N |
| SMILES | C1CNC(C2=C1C=CC(=C2)Br)C(=O)O |
Computed by PubChem (NCBI)