CAS 21440-97-1 appears in our catalog under these names: Brofoxine, 95%, 6-Bromo-4,4-dimethyl-1,4-dihydrobenzo[d][1,3]oxazin-2-one, 98%, 98%, Brofoxine, 6-Bromo-4,4-dimethyl-1,4-dihydrobenzo[d][1,3]oxazin-2-one, 98%, Brofoxine, 98%. Offered by: Combi-blocks, Chemat, MedChemExpress, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 250mg, 100mg, Get quote.
6-bromo-4,4-dimethyl-1H-3,1-benzoxazin-2-one (CAS 21440-97-1) is a chemical compound with the molecular formula C10H10BrNO2 and a molecular weight of 256.10 g/mol. IUPAC name: 6-bromo-4,4-dimethyl-1H-3,1-benzoxazin-2-one. InChIKey: JRXGULDSFFLUAO-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO2 |
|---|---|
| Molecular weight | 256.10 g/mol |
| IUPAC name | 6-bromo-4,4-dimethyl-1H-3,1-benzoxazin-2-one |
| InChIKey | JRXGULDSFFLUAO-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=CC(=C2)Br)NC(=O)O1)C |
Computed by PubChem (NCBI)