2-(2-Bromoethyl)isoindoline-1,3-dione, 98%
cas: 574-98-1 — see every product listed under this CAS number, including other names
2-(2-Bromoethyl)isoindoline-1,3-dione, 98% (CAS 574-98-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 250g, 1kg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A194659-5g |
| cas | 574-98-1 |
| size | 5g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 10g | 197.94 Pln | |
| Ambeed | 25g | 225.75 Pln | |
| Ambeed | 100g | 314.75 Pln | |
| Ambeed | 500g | 1277.06 Pln | |
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 93.20 Pln | |
| Chemat | 100g | 189.20 Pln | |
| Chemat | 250g | 376.40 Pln | |
| Chemat | 500g | 753.60 Pln | |
| Chemat | 1kg | 1355.60 Pln | |
| BLDpharm | 5g | 186.63 Pln | |
| BLDpharm | 10g | 208.84 Pln | |
| BLDpharm | 25g | 236.61 Pln | |
| BLDpharm | 100g | 342.13 Pln | |
| BLDpharm | 500g | 1375.10 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2-(2-bromoethyl)isoindole-1,3-dione (CAS 574-98-1) is a chemical compound with the molecular formula C10H8BrNO2 and a molecular weight of 254.08 g/mol. IUPAC name: 2-(2-bromoethyl)isoindole-1,3-dione. InChIKey: CHZXTOCAICMPQR-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO2 |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | 2-(2-bromoethyl)isoindole-1,3-dione |
| InChIKey | CHZXTOCAICMPQR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCBr |
Computed by PubChem (NCBI)
Synonyms:
1H-Isoindole-1,3(2H)-dione, 2-(2-bromoethyl)-, 1-Bromo-2-phthalimidoethane, 2-(Bromoethyl)phthalimide, beta-Phthalimidoethyl bromide, beta-Bromoethylphthalimide, Phthalimide, N-(2-bromoethyl)-, N-2-Bromoethylphthalimide, Phthalimide, N-(2-bromoethyl)-(8CI), InChI=1/C10H8BrNO2/c11-5-6-12-9(13)7-3-1-2-4-8(7)10(12)14/h1-4H,5-6H, 2-(2-bromoethyl)isoindoline-1,3-dione