CAS 152213-66-6 appears in our catalog under these names: 2-(6-Bromo-1h-indol-3-yl)acetic acid, 95%, 2-(6-Bromo-1H-indol-3-yl)acetic acid, 2-(6-Bromo-1H-indol-3-yl)acetic acid 98%, 2-(6-bromo-1H-indol-3-yl)acetic acid, 98%, 98%, 2-(6-Bromo-1H-indol-3-yl)acetic acid, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g, 10g, 25g.
2-(6-bromo-1H-indol-3-yl)acetic acid (CAS 152213-66-6) is a chemical compound with the molecular formula C10H8BrNO2 and a molecular weight of 254.08 g/mol. IUPAC name: 2-(6-bromo-1H-indol-3-yl)acetic acid. InChIKey: BSYVHEMZTXJMFN-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO2 |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | 2-(6-bromo-1H-indol-3-yl)acetic acid |
| InChIKey | BSYVHEMZTXJMFN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)NC=C2CC(=O)O |
Computed by PubChem (NCBI)