Products 400071-95-6
CAS 400071-95-6 appears in our catalog under these names: 5-Bromo-1-methyl-1H-indole-3-carboxylic acid, 97%, 5-Bromo-1-methyl-1H-indole-3-carboxylic acid, 5-Bromo-1-methyl-1H-indole-3-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, Biosynth, Thermo Scientific (Acros), Chemat, Fluorochem. Available pack sizes: 1g, 25g, 100g, 5g, 10g, 500mg, 1000mg, 2000mg.
5-bromo-1-methylindole-3-carboxylic acid (CAS 400071-95-6) is a chemical compound with the molecular formula C10H8BrNO2 and a molecular weight of 254.08 g/mol. IUPAC name: 5-bromo-1-methylindole-3-carboxylic acid. InChIKey: WQZLFFJMRKTCMU-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO2 |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | 5-bromo-1-methylindole-3-carboxylic acid |
| InChIKey | WQZLFFJMRKTCMU-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=C1C=CC(=C2)Br)C(=O)O |
Computed by PubChem (NCBI)