Products 1805488-00-9
CAS 1805488-00-9 is the registry number for Methyl 3-bromo-6-cyano-2-methylbenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl 3-bromo-6-cyano-2-methylbenzoate (CAS 1805488-00-9) is a chemical compound with the molecular formula C10H8BrNO2 and a molecular weight of 254.08 g/mol. IUPAC name: methyl 3-bromo-6-cyano-2-methylbenzoate. InChIKey: KFPRRPCPTLQWKV-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO2 |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | methyl 3-bromo-6-cyano-2-methylbenzoate |
| InChIKey | KFPRRPCPTLQWKV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1C(=O)OC)C#N)Br |
Computed by PubChem (NCBI)