CAS 1218950-96-9 is the registry number for Methyl 2-(4-bromophenyl)-2-cyanoacetate, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 2-(4-bromophenyl)-2-cyanoacetate (CAS 1218950-96-9) is a chemical compound with the molecular formula C10H8BrNO2 and a molecular weight of 254.08 g/mol. IUPAC name: methyl 2-(4-bromophenyl)-2-cyanoacetate. InChIKey: QWXPRWNVJMNMKQ-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO2 |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | methyl 2-(4-bromophenyl)-2-cyanoacetate |
| InChIKey | QWXPRWNVJMNMKQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C#N)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)