2-(2-Chloro-4-nitrophenyl)acetic Acid, 97%, 97%
cas: 73088-11-6 — see every product listed under this CAS number, including other names
2-(2-Chloro-4-nitrophenyl)acetic Acid, 97%, 97% (CAS 73088-11-6) is a chemical reagent available from Chemat. Available pack sizes: 500g, 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FHE1-500g |
| cas | 73088-11-6 |
| size | 500g |
| availability | 1000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 500g | 8985.60 Pln | |
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 179.60 Pln | |
| Chemat | 5g | 386.00 Pln | |
| Chemat | 10g | 650.00 Pln | |
| Chemat | 25g | 1106.00 Pln | |
| Chemat | 50g | 2128.40 Pln | |
| Chemat | 100g | 2920.40 Pln | |
| Chemat | 250g | 5229.20 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(2-chloro-4-nitrophenyl)acetic acid (CAS 73088-11-6) is a chemical compound with the molecular formula C8H6ClNO4 and a molecular weight of 215.59 g/mol. IUPAC name: 2-(2-chloro-4-nitrophenyl)acetic acid. InChIKey: BYVVWINDBFSBQK-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO4 |
|---|---|
| Molecular weight | 215.59 g/mol |
| IUPAC name | 2-(2-chloro-4-nitrophenyl)acetic acid |
| InChIKey | BYVVWINDBFSBQK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])Cl)CC(=O)O |
Computed by PubChem (NCBI)