Products 23066-21-9
CAS 23066-21-9 appears in our catalog under these names: 3-Chloro-2-nitrophenylacetic acid, 95%, 3-Chloro-2-nitrophenylacetic acid, 97%, 3–Chloro–2–nitrophenylacetic Acid, 3-Chloro-2-nitrophenylacetic acid, >97%, >97%, 2-(3-Chloro-2-nitrophenyl)acetic acid. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 10g, 100mg.
2-(3-chloro-2-nitrophenyl)acetic acid (CAS 23066-21-9) is a chemical compound with the molecular formula C8H6ClNO4 and a molecular weight of 215.59 g/mol. IUPAC name: 2-(3-chloro-2-nitrophenyl)acetic acid. InChIKey: BLJTYQBHLXPJPG-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO4 |
|---|---|
| Molecular weight | 215.59 g/mol |
| IUPAC name | 2-(3-chloro-2-nitrophenyl)acetic acid |
| InChIKey | BLJTYQBHLXPJPG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)[N+](=O)[O-])CC(=O)O |
Computed by PubChem (NCBI)