CAS 37777-71-2 appears in our catalog under these names: 2-(4-Chloro-2-nitrophenyl)acetic acid, 95%, 2-(4-Chloro-2-nitrophenyl)acetic Acid, 98%, 98%, 4-Chloro-2-nitrophenylacetic acid, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 10g, 100g.
2-(4-chloro-2-nitrophenyl)acetic acid (CAS 37777-71-2) is a chemical compound with the molecular formula C8H6ClNO4 and a molecular weight of 215.59 g/mol. IUPAC name: 2-(4-chloro-2-nitrophenyl)acetic acid. InChIKey: FLZUSUKBKOZJLG-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO4 |
|---|---|
| Molecular weight | 215.59 g/mol |
| IUPAC name | 2-(4-chloro-2-nitrophenyl)acetic acid |
| InChIKey | FLZUSUKBKOZJLG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)[N+](=O)[O-])CC(=O)O |
Computed by PubChem (NCBI)