2-(2-Ethoxy-4-formylphenoxy)-N-ethylacetamide, 95%
cas: 746608-49-1 — see every product listed under this CAS number, including other names
2-(2-Ethoxy-4-formylphenoxy)-N-ethylacetamide, 95% (CAS 746608-49-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1010901-100mg |
| cas | 746608-49-1 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 225.75 Pln | |
| Ambeed | 250mg | 353.69 Pln | |
| Ambeed | 1g | 832.06 Pln | |
| Chemat | 100mg | 280.40 Pln | |
| Chemat | 250mg | 434.00 Pln | |
| Chemat | 1g | 1029.20 Pln | |
| BLDpharm | 100mg | 236.61 Pln | |
| BLDpharm | 250mg | 375.45 Pln | |
| BLDpharm | 1g | 891.93 Pln | |
| Fluorochem | 100mg | 497.76 Pln | |
| Fluorochem | 250mg | 789.32 Pln | |
| Fluorochem | 1g | 1898.31 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2-(2-ethoxy-4-formylphenoxy)-N-ethylacetamide (CAS 746608-49-1) is a chemical compound with the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. IUPAC name: 2-(2-ethoxy-4-formylphenoxy)-N-ethylacetamide. InChIKey: AIXZVWKVCPEYLB-UHFFFAOYSA-N.
| Molecular formula | C13H17NO4 |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | 2-(2-ethoxy-4-formylphenoxy)-N-ethylacetamide |
| InChIKey | AIXZVWKVCPEYLB-UHFFFAOYSA-N |
| SMILES | CCNC(=O)COC1=C(C=C(C=C1)C=O)OCC |
Computed by PubChem (NCBI)