CAS 1260670-85-6 appears in our catalog under these names: (2-Formyl-4-methoxy-phenyl)-carbamic acid tert-butyl ester, 95%, tert–Butyl (2–formyl–4–methoxyphenyl)carbamate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 250mg, 1g, 100mg.
Tert-butyl N-(2-formyl-4-methoxyphenyl)carbamate (CAS 1260670-85-6) is a chemical compound with the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. IUPAC name: tert-butyl N-(2-formyl-4-methoxyphenyl)carbamate. InChIKey: YVUGPPHGUHDVES-UHFFFAOYSA-N.
| Molecular formula | C13H17NO4 |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | tert-butyl N-(2-formyl-4-methoxyphenyl)carbamate |
| InChIKey | YVUGPPHGUHDVES-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=C(C=C1)OC)C=O |
Computed by PubChem (NCBI)