Products 24164-72-5
CAS 24164-72-5 appears in our catalog under these names: methyl (2S)-2-{[(benzyloxy)carbonyl](methyl)amino}propanoate, 96%, Methyl (2S)-2-{((benzyloxy)carbonyl)(methyl)amino}propanoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
Methyl (2S)-2-[methyl(phenylmethoxycarbonyl)amino]propanoate (CAS 24164-72-5) is a chemical compound with the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. IUPAC name: methyl (2S)-2-[methyl(phenylmethoxycarbonyl)amino]propanoate. InChIKey: RZYCUYKUGGKLIL-JTQLQIEISA-N.
| Molecular formula | C13H17NO4 |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | methyl (2S)-2-[methyl(phenylmethoxycarbonyl)amino]propanoate |
| InChIKey | RZYCUYKUGGKLIL-JTQLQIEISA-N |
| SMILES | C[C@@H](C(=O)OC)N(C)C(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)