CAS 231958-04-6 appears in our catalog under these names: Boc-3-amino-4-methylbenzoic acid, 95%, Boc-3-amino-4-methylbenzoic acid, Boc-3-amino-4-methylbenzoic acid 98%, 3-((tert-Butoxycarbonyl)amino)-4-methylbenzoic acid, 98%, 98%, 3-((tert-Butoxycarbonyl)amino)-4-methylbenzoic acid, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 10g, 5g, 1g, 25g.
4-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid (CAS 231958-04-6) is a chemical compound with the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. IUPAC name: 4-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid. InChIKey: ITZUJURBEZPZOD-UHFFFAOYSA-N.
| Molecular formula | C13H17NO4 |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | 4-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid |
| InChIKey | ITZUJURBEZPZOD-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)