CAS 180976-94-7 appears in our catalog under these names: Boc-4-amino-3-methylbenzoic acid, 97%, 4–((tert–Butoxycarbonyl)amino)–3–methylbenzoic acid, Boc-4-amino-3-methylbenzoic acid, 4-((tert-Butoxycarbonyl)amino)-3-methylbenzoic acid 97%, Boc-4-amino-3-methylbenzoic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 25g, 10g, 5g, 2,5g, 100mg.
3-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid (CAS 180976-94-7) is a chemical compound with the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. IUPAC name: 3-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid. InChIKey: DATSAXPXARPPIG-UHFFFAOYSA-N.
| Molecular formula | C13H17NO4 |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | 3-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid |
| InChIKey | DATSAXPXARPPIG-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)