cas: 853910-00-6 — see every product listed under this CAS number, including other names
2-(2-Fluoro-4-nitrophenyl)acetonitrile, 95% (CAS 853910-00-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F459369-250MG |
| cas | 853910-00-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 112.48 Pln | |
| Fluorochem | 1g | 185.37 Pln | |
| Fluorochem | 5g | 466.52 Pln | |
| Fluorochem | 10g | 877.83 Pln | |
| Fluorochem | 25g | 2101.36 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-(2-fluoro-4-nitrophenyl)acetonitrile (CAS 853910-00-6) is a chemical compound with the molecular formula C8H5FN2O2 and a molecular weight of 180.14 g/mol. IUPAC name: 2-(2-fluoro-4-nitrophenyl)acetonitrile. InChIKey: YTILGOKQDCCMQS-UHFFFAOYSA-N.
| Molecular formula | C8H5FN2O2 |
|---|---|
| Molecular weight | 180.14 g/mol |
| IUPAC name | 2-(2-fluoro-4-nitrophenyl)acetonitrile |
| InChIKey | YTILGOKQDCCMQS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])F)CC#N |
Computed by PubChem (NCBI)