CAS 1695920-54-7 appears in our catalog under these names: 2-Fluoro-4-methyl-5-nitrobenzonitrile, 95%, 2-Fluoro-4-methyl-5-nitrobenzonitrile, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 25g.
2-fluoro-4-methyl-5-nitrobenzonitrile (CAS 1695920-54-7) is a chemical compound with the molecular formula C8H5FN2O2 and a molecular weight of 180.14 g/mol. IUPAC name: 2-fluoro-4-methyl-5-nitrobenzonitrile. InChIKey: FSHNWWKZVLPEQS-UHFFFAOYSA-N.
| Molecular formula | C8H5FN2O2 |
|---|---|
| Molecular weight | 180.14 g/mol |
| IUPAC name | 2-fluoro-4-methyl-5-nitrobenzonitrile |
| InChIKey | FSHNWWKZVLPEQS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1[N+](=O)[O-])C#N)F |
Computed by PubChem (NCBI)