cas: 1689547-84-9 — see every product listed under this CAS number, including other names
2-(2-Methoxy-4-(trifluoromethyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98% (CAS 1689547-84-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 2g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F749576-1G |
| cas | 1689547-84-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 607.10 Pln | |
| Fluorochem | 2g | 1034.03 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2-[2-methoxy-4-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1689547-84-9) is a chemical compound with the molecular formula C14H18BF3O3 and a molecular weight of 302.10 g/mol. IUPAC name: 2-[2-methoxy-4-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: SBFFVWNJNYFDCJ-UHFFFAOYSA-N.
| Molecular formula | C14H18BF3O3 |
|---|---|
| Molecular weight | 302.10 g/mol |
| IUPAC name | 2-[2-methoxy-4-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | SBFFVWNJNYFDCJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C(F)(F)F)OC |
Computed by PubChem (NCBI)