CAS 1150561-56-0 is the registry number for 3-Methyl-5-(trifluoromethoxy)phenylboronic acid, pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4,4,5,5-tetramethyl-2-[3-methyl-5-(trifluoromethoxy)phenyl]-1,3,2-dioxaborolane (CAS 1150561-56-0) is a chemical compound with the molecular formula C14H18BF3O3 and a molecular weight of 302.10 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[3-methyl-5-(trifluoromethoxy)phenyl]-1,3,2-dioxaborolane. InChIKey: FTVLDBHZEMFMKS-UHFFFAOYSA-N.
| Molecular formula | C14H18BF3O3 |
|---|---|
| Molecular weight | 302.10 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[3-methyl-5-(trifluoromethoxy)phenyl]-1,3,2-dioxaborolane |
| InChIKey | FTVLDBHZEMFMKS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)OC(F)(F)F)C |
Computed by PubChem (NCBI)