CAS 886528-42-3 appears in our catalog under these names: 4-(2,2,2-Trifluoroethoxy)phenylboronic acid pinacol ester, 96%, 4-(2,2,2-Trifluoroethoxy)phenylboronic acid pinacol ester, 98%, 98%, 4,4,5,5-tetramethyl-2-(4-(2,2,2-trifluoroethoxy)phenyl)-1,3,2-dioxaborolane, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 5g, 1g, 100mg, 250mg.
4,4,5,5-tetramethyl-2-[4-(2,2,2-trifluoroethoxy)phenyl]-1,3,2-dioxaborolane (CAS 886528-42-3) is a chemical compound with the molecular formula C14H18BF3O3 and a molecular weight of 302.10 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[4-(2,2,2-trifluoroethoxy)phenyl]-1,3,2-dioxaborolane. InChIKey: FMASTXATFLPSON-UHFFFAOYSA-N.
| Molecular formula | C14H18BF3O3 |
|---|---|
| Molecular weight | 302.10 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[4-(2,2,2-trifluoroethoxy)phenyl]-1,3,2-dioxaborolane |
| InChIKey | FMASTXATFLPSON-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OCC(F)(F)F |
Computed by PubChem (NCBI)