CAS 2377611-99-7 is the registry number for 4-Hydroxymethyl-2-(trifluoromethyl)phenylboronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)phenyl]methanol (CAS 2377611-99-7) is a chemical compound with the molecular formula C14H18BF3O3 and a molecular weight of 302.10 g/mol. IUPAC name: [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)phenyl]methanol. InChIKey: BIZQWCCYLHTYNE-UHFFFAOYSA-N.
| Molecular formula | C14H18BF3O3 |
|---|---|
| Molecular weight | 302.10 g/mol |
| IUPAC name | [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)phenyl]methanol |
| InChIKey | BIZQWCCYLHTYNE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)CO)C(F)(F)F |
Computed by PubChem (NCBI)