CAS 872038-32-9 appears in our catalog under these names: 4-(Trifluoromethoxy)phenylmethylboronic acid, pinacol ester, 97%, 4-(Trifluoromethoxy)benzylboronic acid pinacol ester, 95%, 4–(Trifluoromethoxy)benzylboronic acid pinacol ester, 4-(Trifluoromethoxy)benzylboronic acid pinacol ester 95%, 4,4,5,5-Tetramethyl-2-(4-(trifluoromethoxy)benzyl)-1,3,2-dioxaborolane, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
4,4,5,5-tetramethyl-2-[[4-(trifluoromethoxy)phenyl]methyl]-1,3,2-dioxaborolane (CAS 872038-32-9) is a chemical compound with the molecular formula C14H18BF3O3 and a molecular weight of 302.10 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[[4-(trifluoromethoxy)phenyl]methyl]-1,3,2-dioxaborolane. InChIKey: CQXXCBRJJSMFRZ-UHFFFAOYSA-N.
| Molecular formula | C14H18BF3O3 |
|---|---|
| Molecular weight | 302.10 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[[4-(trifluoromethoxy)phenyl]methyl]-1,3,2-dioxaborolane |
| InChIKey | CQXXCBRJJSMFRZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CC2=CC=C(C=C2)OC(F)(F)F |
Computed by PubChem (NCBI)