CAS 21905-73-7 appears in our catalog under these names: 2–(2–Methoxyphenoxy)benzoic acid, 2-(2-Methoxyphenoxy)Benzoic Acid, 2-(2-Methoxyphenoxy)benzoic acid, 97%, 97%, 2-(2-METHOXYPHENOXY)BENZOIC ACID, 95%, 2-(2-Methoxyphenoxy)benzoic acid, 97%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 500mg, 1000mg, 2000mg, 1g, 5g, 10g.
2-(2-methoxyphenoxy)benzoic acid (CAS 21905-73-7) is a chemical compound with the molecular formula C14H12O4 and a molecular weight of 244.24 g/mol. IUPAC name: 2-(2-methoxyphenoxy)benzoic acid. InChIKey: LFWIIPSSDWXVJZ-UHFFFAOYSA-N.
| Molecular formula | C14H12O4 |
|---|---|
| Molecular weight | 244.24 g/mol |
| IUPAC name | 2-(2-methoxyphenoxy)benzoic acid |
| InChIKey | LFWIIPSSDWXVJZ-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1OC2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)