CAS 1215206-03-3 appears in our catalog under these names: 2'-Hydroxy-5'-methoxybiphenyl-3-carboxylic acid, 95%, 2'–Hydroxy–5'–methoxy–(1,1'–biphenyl)–3–carboxylic acid, 2'-Hydroxy-5'-methoxy-[1,1'-biphenyl]-3-carboxylic acid, 95%, 95%, 2'-Hydroxy-5'-methoxy-[1,1'-biphenyl]-3-carboxylic acid, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
3-(2-hydroxy-5-methoxyphenyl)benzoic acid (CAS 1215206-03-3) is a chemical compound with the molecular formula C14H12O4 and a molecular weight of 244.24 g/mol. IUPAC name: 3-(2-hydroxy-5-methoxyphenyl)benzoic acid. InChIKey: MAPDAJJJYRUXGN-UHFFFAOYSA-N.
| Molecular formula | C14H12O4 |
|---|---|
| Molecular weight | 244.24 g/mol |
| IUPAC name | 3-(2-hydroxy-5-methoxyphenyl)benzoic acid |
| InChIKey | MAPDAJJJYRUXGN-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)O)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)