CAS 1215206-61-3 is the registry number for 4'-Hydroxy-3'-methoxybiphenyl-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-(4-hydroxy-3-methoxyphenyl)benzoic acid (CAS 1215206-61-3) is a chemical compound with the molecular formula C14H12O4 and a molecular weight of 244.24 g/mol. IUPAC name: 3-(4-hydroxy-3-methoxyphenyl)benzoic acid. InChIKey: CJSQCDOAVLQBRY-UHFFFAOYSA-N.
| Molecular formula | C14H12O4 |
|---|---|
| Molecular weight | 244.24 g/mol |
| IUPAC name | 3-(4-hydroxy-3-methoxyphenyl)benzoic acid |
| InChIKey | CJSQCDOAVLQBRY-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C2=CC(=CC=C2)C(=O)O)O |
Computed by PubChem (NCBI)