CAS 50687-62-2 appears in our catalog under these names: 4-Hydroxybenzoic acid 4-methoxyphenyl ester, 95%, 4–Methoxyphenyl 4–Hydroxybenzoate, 4-Methoxyphenyl 4-Hydroxybenzoate, 4-Methoxyphenyl 4-Hydroxybenzoate, >99.0%(GC), 4-Hydroxybenzoic Acid 4-Methoxyphenyl Ester. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Chemat. Available pack sizes: 10g, 1g, 5g, 25g, 2g, 250mg.
(4-methoxyphenyl) 4-hydroxybenzoate (CAS 50687-62-2) is a chemical compound with the molecular formula C14H12O4 and a molecular weight of 244.24 g/mol. IUPAC name: (4-methoxyphenyl) 4-hydroxybenzoate. InChIKey: MTQSVJUCLQYISS-UHFFFAOYSA-N.
| Molecular formula | C14H12O4 |
|---|---|
| Molecular weight | 244.24 g/mol |
| IUPAC name | (4-methoxyphenyl) 4-hydroxybenzoate |
| InChIKey | MTQSVJUCLQYISS-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)OC(=O)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)