Products 1215206-20-4

CAS 1215206-20-4 is the registry number for 2'-Hydroxy-4'-methoxybiphenyl-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

3-(2-hydroxy-4-methoxyphenyl)benzoic acid (CAS 1215206-20-4) is a chemical compound with the molecular formula C14H12O4 and a molecular weight of 244.24 g/mol. IUPAC name: 3-(2-hydroxy-4-methoxyphenyl)benzoic acid. InChIKey: SGIRAIBKNTZLQA-UHFFFAOYSA-N.

Identity
Molecular formulaC14H12O4
Molecular weight244.24 g/mol
IUPAC name3-(2-hydroxy-4-methoxyphenyl)benzoic acid
InChIKeySGIRAIBKNTZLQA-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1)C2=CC(=CC=C2)C(=O)O)O

Computed by PubChem (NCBI)