cas: 96356-12-6 — see every product listed under this CAS number, including other names
2-(2-Methylimidazo(2,1-b)(1,3,4)thiadiazol-6-yl)acetic acid, 95+% (CAS 96356-12-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 25g, 100mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A527800-5g |
| cas | 96356-12-6 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 22158.43 Pln | |
| AmBeed | 1g | 6925.03 Pln | |
| AmBeed | 25g | 55333.39 Pln | |
| AmBeed | 100mg | 2023.00 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)acetic acid (CAS 96356-12-6) is a chemical compound with the molecular formula C7H7N3O2S and a molecular weight of 197.22 g/mol. IUPAC name: 2-(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)acetic acid. InChIKey: UXNWAVVHBGSHCY-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O2S |
|---|---|
| Molecular weight | 197.22 g/mol |
| IUPAC name | 2-(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)acetic acid |
| InChIKey | UXNWAVVHBGSHCY-UHFFFAOYSA-N |
| SMILES | CC1=NN2C=C(N=C2S1)CC(=O)O |
Computed by PubChem (NCBI)