CAS 626226-54-8 is the registry number for 7-Hydroxy-2-(methylamino)[1,3]thiazolo[4,5-b]pyridin-5(4h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
7-hydroxy-2-(methylamino)-4H-[1,3]thiazolo[4,5-b]pyridin-5-one (CAS 626226-54-8) is a chemical compound with the molecular formula C7H7N3O2S and a molecular weight of 197.22 g/mol. IUPAC name: 7-hydroxy-2-(methylamino)-4H-[1,3]thiazolo[4,5-b]pyridin-5-one. InChIKey: VOVRAHNUMSFRIG-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O2S |
|---|---|
| Molecular weight | 197.22 g/mol |
| IUPAC name | 7-hydroxy-2-(methylamino)-4H-[1,3]thiazolo[4,5-b]pyridin-5-one |
| InChIKey | VOVRAHNUMSFRIG-UHFFFAOYSA-N |
| SMILES | CNC1=NC2=C(S1)C(=CC(=O)N2)O |
Computed by PubChem (NCBI)