CAS 709-72-8 appears in our catalog under these names: 1-(3-Nitrophenyl)-2-thiourea, 95%, 1-(3-Nitrophenyl)-2-thiourea. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g.
(3-nitrophenyl)thiourea (CAS 709-72-8) is a chemical compound with the molecular formula C7H7N3O2S and a molecular weight of 197.22 g/mol. IUPAC name: (3-nitrophenyl)thiourea. InChIKey: HQEMUQNZGCZHHN-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O2S |
|---|---|
| Molecular weight | 197.22 g/mol |
| IUPAC name | (3-nitrophenyl)thiourea |
| InChIKey | HQEMUQNZGCZHHN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])NC(=S)N |
Computed by PubChem (NCBI)