CAS 96356-12-6 appears in our catalog under these names: 2-(2-Methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)acetic acid, 95%, 2-(2-Methylimidazo(2,1-b)(1,3,4)thiadiazol-6-yl)acetic acid, 95+%, 2–(2–Methylimidazo(2,1–b)(1,3,4)thiadiazol–6–yl)acetic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg.
2-(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)acetic acid (CAS 96356-12-6) is a chemical compound with the molecular formula C7H7N3O2S and a molecular weight of 197.22 g/mol. IUPAC name: 2-(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)acetic acid. InChIKey: UXNWAVVHBGSHCY-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O2S |
|---|---|
| Molecular weight | 197.22 g/mol |
| IUPAC name | 2-(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)acetic acid |
| InChIKey | UXNWAVVHBGSHCY-UHFFFAOYSA-N |
| SMILES | CC1=NN2C=C(N=C2S1)CC(=O)O |
Computed by PubChem (NCBI)