CAS 96356-08-0 is the registry number for 2-Ethylimidazo(2,1-b)(1,3,4)thiadiazole-6-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.
2-ethylimidazo[2,1-b][1,3,4]thiadiazole-6-carboxylic acid (CAS 96356-08-0) is a chemical compound with the molecular formula C7H7N3O2S and a molecular weight of 197.22 g/mol. IUPAC name: 2-ethylimidazo[2,1-b][1,3,4]thiadiazole-6-carboxylic acid. InChIKey: JEXSADKEJFQTLQ-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O2S |
|---|---|
| Molecular weight | 197.22 g/mol |
| IUPAC name | 2-ethylimidazo[2,1-b][1,3,4]thiadiazole-6-carboxylic acid |
| InChIKey | JEXSADKEJFQTLQ-UHFFFAOYSA-N |
| SMILES | CCC1=NN2C=C(N=C2S1)C(=O)O |
Computed by PubChem (NCBI)