cas: 1956354-52-1 — see every product listed under this CAS number, including other names
2-(2-Oxa-6-azaspiro[3.3]heptan-6-yl)ethanamine oxalate, 95%, 95% (CAS 1956354-52-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FWML-100mg |
| cas | 1956354-52-1 |
| size | 100mg |
| availability | 25g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 434.00 Pln | |
| Chemat | 250mg | 621.20 Pln | |
| Chemat | 500mg | 990.80 Pln | |
| Chemat | 1g | 1456.40 Pln | |
| Chemat | 5g | 4240.40 Pln | |
| Chemat | 10g | 7024.40 Pln | |
| Chemat | 25g | 13989.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(2-oxa-6-azaspiro[3.3]heptan-6-yl)ethanamine;oxalic acid (CAS 1956354-52-1) is a chemical compound with the molecular formula C9H16N2O5 and a molecular weight of 232.23 g/mol. IUPAC name: 2-(2-oxa-6-azaspiro[3.3]heptan-6-yl)ethanamine;oxalic acid. InChIKey: LWGGYBRFWRCGKP-UHFFFAOYSA-N.
| Molecular formula | C9H16N2O5 |
|---|---|
| Molecular weight | 232.23 g/mol |
| IUPAC name | 2-(2-oxa-6-azaspiro[3.3]heptan-6-yl)ethanamine;oxalic acid |
| InChIKey | LWGGYBRFWRCGKP-UHFFFAOYSA-N |
| SMILES | C1C2(CN1CCN)COC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)