CAS 1956354-52-1 appears in our catalog under these names: 2-(2-Oxa-6-azaspiro(3.3)heptan-6-yl)ethanamine oxalate, 95+%, 2-(2-Oxa-6-azaspiro[3.3]heptan-6-yl)ethanamine oxalate, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 10g, 100mg, 250mg, 500mg, 1g, 5g, 25g.
2-(2-oxa-6-azaspiro[3.3]heptan-6-yl)ethanamine;oxalic acid (CAS 1956354-52-1) is a chemical compound with the molecular formula C9H16N2O5 and a molecular weight of 232.23 g/mol. IUPAC name: 2-(2-oxa-6-azaspiro[3.3]heptan-6-yl)ethanamine;oxalic acid. InChIKey: LWGGYBRFWRCGKP-UHFFFAOYSA-N.
| Molecular formula | C9H16N2O5 |
|---|---|
| Molecular weight | 232.23 g/mol |
| IUPAC name | 2-(2-oxa-6-azaspiro[3.3]heptan-6-yl)ethanamine;oxalic acid |
| InChIKey | LWGGYBRFWRCGKP-UHFFFAOYSA-N |
| SMILES | C1C2(CN1CCN)COC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)