CAS 142847-17-4 appears in our catalog under these names: 4-Amino-2-[(tert-butoxycarbonyl)amino]-4-oxobutanoic acid, 95%, N2-[(1,1-Dimethylethoxy)carbonyl]asparagine, 97%, 97%, Boc-DL-Asn-OH, 97%. Offered by: Combi-blocks, Chemat, Ambeed. Available pack sizes: 10g, 5g, 1g, 25g.
4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid (CAS 142847-17-4) is a chemical compound with the molecular formula C9H16N2O5 and a molecular weight of 232.23 g/mol. IUPAC name: 4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid. InChIKey: FYYSQDHBALBGHX-UHFFFAOYSA-N.
| Molecular formula | C9H16N2O5 |
|---|---|
| Molecular weight | 232.23 g/mol |
| IUPAC name | 4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid |
| InChIKey | FYYSQDHBALBGHX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)N)C(=O)O |
Computed by PubChem (NCBI)