CAS 2102409-52-7 appears in our catalog under these names: Cis-octahydropyrrolo[1,2-a]piperazin-7-ol oxalic acid, 95%, cis-octahydropyrrolo(1,2-a)piperazin-7-ol, oxalic acid, 98+%, (7R,8aS)-Octahydropyrrolo[1,2-a]pyrazin-7-ol oxalate, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 500mg, 1g, 5g, 100mg, 250mg.
(7R,8aS)-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-7-ol;oxalic acid (CAS 2102409-52-7) is a chemical compound with the molecular formula C9H16N2O5 and a molecular weight of 232.23 g/mol. IUPAC name: (7R,8aS)-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-7-ol;oxalic acid. InChIKey: JVTWONPGZQKRTM-UOERWJHTSA-N.
| Molecular formula | C9H16N2O5 |
|---|---|
| Molecular weight | 232.23 g/mol |
| IUPAC name | (7R,8aS)-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-7-ol;oxalic acid |
| InChIKey | JVTWONPGZQKRTM-UOERWJHTSA-N |
| SMILES | C1CN2C[C@@H](C[C@H]2CN1)O.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)