CAS 2740592-93-0 appears in our catalog under these names: (7R,8AR)-octahydropyrrolo(1,2-a)pyrazin-7-ol oxalate, 97%, (7R,8AR)-octahydropyrrolo[1,2-a]pyrazin-7-ol oxalate, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg, 500mg.
(7R,8aR)-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-7-ol;oxalic acid (CAS 2740592-93-0) is a chemical compound with the molecular formula C9H16N2O5 and a molecular weight of 232.23 g/mol. IUPAC name: (7R,8aR)-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-7-ol;oxalic acid. InChIKey: JVTWONPGZQKRTM-ZJLYAJKPSA-N.
| Molecular formula | C9H16N2O5 |
|---|---|
| Molecular weight | 232.23 g/mol |
| IUPAC name | (7R,8aR)-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-7-ol;oxalic acid |
| InChIKey | JVTWONPGZQKRTM-ZJLYAJKPSA-N |
| SMILES | C1CN2C[C@@H](C[C@@H]2CN1)O.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)