cas: 60075-23-2 — see every product listed under this CAS number, including other names
2-(3,4-Dimethoxyphenyl)acetohydrazide 95% (CAS 60075-23-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A290888-1g |
| cas | 60075-23-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 253.56 Pln | |
| Ambeed | 25g | 592.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A290888 |
2-(3,4-dimethoxyphenyl)acetohydrazide (CAS 60075-23-2) is a chemical compound with the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. IUPAC name: 2-(3,4-dimethoxyphenyl)acetohydrazide. InChIKey: HRMXYTRKEOUMNG-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O3 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 2-(3,4-dimethoxyphenyl)acetohydrazide |
| InChIKey | HRMXYTRKEOUMNG-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)CC(=O)NN)OC |
Computed by PubChem (NCBI)