cas: 60075-23-2 — see every product listed under this CAS number, including other names
2-(3,4-Dimethoxyphenyl)acetohydrazide, 95%, 95% (CAS 60075-23-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114IIC-1g |
| cas | 60075-23-2 |
| size | 1g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 179.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(3,4-dimethoxyphenyl)acetohydrazide (CAS 60075-23-2) is a chemical compound with the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. IUPAC name: 2-(3,4-dimethoxyphenyl)acetohydrazide. InChIKey: HRMXYTRKEOUMNG-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O3 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 2-(3,4-dimethoxyphenyl)acetohydrazide |
| InChIKey | HRMXYTRKEOUMNG-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)CC(=O)NN)OC |
Computed by PubChem (NCBI)