CAS 2225176-23-6 is the registry number for 2,5–Dimethyl–3–cyclopropylphenylboronic acid. Offered by: GLPBio. Available pack sizes: 25mg.
(3-cyclopropyl-2,5-dimethylphenyl)boronic acid (CAS 2225176-23-6) is a chemical compound with the molecular formula C11H15BO2 and a molecular weight of 190.05 g/mol. IUPAC name: (3-cyclopropyl-2,5-dimethylphenyl)boronic acid. InChIKey: CJZDPMZNDXSCMO-UHFFFAOYSA-N.
| Molecular formula | C11H15BO2 |
|---|---|
| Molecular weight | 190.05 g/mol |
| IUPAC name | (3-cyclopropyl-2,5-dimethylphenyl)boronic acid |
| InChIKey | CJZDPMZNDXSCMO-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1C)C2CC2)C)(O)O |
Computed by PubChem (NCBI)