CAS 2225172-58-5 is the registry number for 2,5–Dimethyl–4–cyclopropylphenylboronic acid. Offered by: GLPBio. Available pack sizes: 25mg.
(4-cyclopropyl-2,5-dimethylphenyl)boronic acid (CAS 2225172-58-5) is a chemical compound with the molecular formula C11H15BO2 and a molecular weight of 190.05 g/mol. IUPAC name: (4-cyclopropyl-2,5-dimethylphenyl)boronic acid. InChIKey: QHZYPSXVICXSGO-UHFFFAOYSA-N.
| Molecular formula | C11H15BO2 |
|---|---|
| Molecular weight | 190.05 g/mol |
| IUPAC name | (4-cyclopropyl-2,5-dimethylphenyl)boronic acid |
| InChIKey | QHZYPSXVICXSGO-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1C)C2CC2)C)(O)O |
Computed by PubChem (NCBI)