cas: 1046811-99-7 — see every product listed under this CAS number, including other names
2-(3,4-dihydro-2H-pyran-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 96%, 96% (CAS 1046811-99-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114ESW-100mg |
| cas | 1046811-99-7 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 285.20 Pln | |
| Chemat | 250mg | 544.40 Pln | |
| Chemat | 1g | 1091.60 Pln | |
| Chemat | 5g | 4374.80 Pln | |
| Chemat | 10g | 7365.20 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-(3,4-dihydro-2H-pyran-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1046811-99-7) is a chemical compound with the molecular formula C11H19BO3 and a molecular weight of 210.08 g/mol. IUPAC name: 2-(3,4-dihydro-2H-pyran-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: UQPQMEFVQNERGS-UHFFFAOYSA-N.
| Molecular formula | C11H19BO3 |
|---|---|
| Molecular weight | 210.08 g/mol |
| IUPAC name | 2-(3,4-dihydro-2H-pyran-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | UQPQMEFVQNERGS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=COCCC2 |
Computed by PubChem (NCBI)