CAS 2223042-59-7 is the registry number for 2,3–Dihydro–5–methylfuran–4–boronic acid pinacol ester. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
4,4,5,5-tetramethyl-2-(5-methyl-2,3-dihydrofuran-4-yl)-1,3,2-dioxaborolane (CAS 2223042-59-7) is a chemical compound with the molecular formula C11H19BO3 and a molecular weight of 210.08 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(5-methyl-2,3-dihydrofuran-4-yl)-1,3,2-dioxaborolane. InChIKey: JUQCLKZAHDRORK-UHFFFAOYSA-N.
| Molecular formula | C11H19BO3 |
|---|---|
| Molecular weight | 210.08 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(5-methyl-2,3-dihydrofuran-4-yl)-1,3,2-dioxaborolane |
| InChIKey | JUQCLKZAHDRORK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(OCC2)C |
Computed by PubChem (NCBI)