CAS 2609866-15-9 is the registry number for 3-((4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)methyl)cyclobutan-1-one, 98%. Offered by: AmBeed. Available pack sizes: 1g.
3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]cyclobutan-1-one (CAS 2609866-15-9) is a chemical compound with the molecular formula C11H19BO3 and a molecular weight of 210.08 g/mol. IUPAC name: 3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]cyclobutan-1-one. InChIKey: UDNHQMPAKPJWFN-UHFFFAOYSA-N.
| Molecular formula | C11H19BO3 |
|---|---|
| Molecular weight | 210.08 g/mol |
| IUPAC name | 3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]cyclobutan-1-one |
| InChIKey | UDNHQMPAKPJWFN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CC2CC(=O)C2 |
Computed by PubChem (NCBI)