CAS 2415382-70-4 is the registry number for 2-(3-Oxabicyclo[3.1.0]hexan-6-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,4,5,5-tetramethyl-2-(3-oxabicyclo[3.1.0]hexan-6-yl)-1,3,2-dioxaborolane (CAS 2415382-70-4) is a chemical compound with the molecular formula C11H19BO3 and a molecular weight of 210.08 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(3-oxabicyclo[3.1.0]hexan-6-yl)-1,3,2-dioxaborolane. InChIKey: HHJSEQDSZMCBIO-UHFFFAOYSA-N.
| Molecular formula | C11H19BO3 |
|---|---|
| Molecular weight | 210.08 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(3-oxabicyclo[3.1.0]hexan-6-yl)-1,3,2-dioxaborolane |
| InChIKey | HHJSEQDSZMCBIO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2C3C2COC3 |
Computed by PubChem (NCBI)