CAS 773094-77-2 appears in our catalog under these names: 2-(3,5-Dibromophenyl)-1,3-dioxolane, 95%, 2-(3,5-Dibromophenyl)-1,3-dioxolane, 98%, 2-(3,5-Dibromophenyl)-1,3-dioxolane, ≥95%, 2-(3,5-Dibromophenyl)-1,3-dioxolane, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Fluorochem, Chemat. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
2-(3,5-dibromophenyl)-1,3-dioxolane (CAS 773094-77-2) is a chemical compound with the molecular formula C9H8Br2O2 and a molecular weight of 307.97 g/mol. IUPAC name: 2-(3,5-dibromophenyl)-1,3-dioxolane. InChIKey: OBXZDDQGPKSYIL-UHFFFAOYSA-N.
| Molecular formula | C9H8Br2O2 |
|---|---|
| Molecular weight | 307.97 g/mol |
| IUPAC name | 2-(3,5-dibromophenyl)-1,3-dioxolane |
| InChIKey | OBXZDDQGPKSYIL-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=CC(=CC(=C2)Br)Br |
Computed by PubChem (NCBI)