2-(3,5-Dimethylphenyl)-1,3,2-dioxaborinane, 98%
cas: 436853-63-3 — see every product listed under this CAS number, including other names
2-(3,5-Dimethylphenyl)-1,3,2-dioxaborinane, 98% (CAS 436853-63-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Fluorochem, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1205954-250mg |
| cas | 436853-63-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 142.31 Pln | |
| Ambeed | 1g | 186.81 Pln | |
| Ambeed | 5g | 448.25 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 197.73 Pln | |
| BLDpharm | 5g | 475.41 Pln | |
| Fluorochem | 250mg | 169.75 Pln | |
| Fluorochem | 1g | 320.74 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 184.40 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2-(3,5-dimethylphenyl)-1,3,2-dioxaborinane (CAS 436853-63-3) is a chemical compound with the molecular formula C11H15BO2 and a molecular weight of 190.05 g/mol. IUPAC name: 2-(3,5-dimethylphenyl)-1,3,2-dioxaborinane. InChIKey: BBDURTGMHLDAQY-UHFFFAOYSA-N.
| Molecular formula | C11H15BO2 |
|---|---|
| Molecular weight | 190.05 g/mol |
| IUPAC name | 2-(3,5-dimethylphenyl)-1,3,2-dioxaborinane |
| InChIKey | BBDURTGMHLDAQY-UHFFFAOYSA-N |
| SMILES | B1(OCCCO1)C2=CC(=CC(=C2)C)C |
Computed by PubChem (NCBI)