CAS 2402-67-7 appears in our catalog under these names: 2–(3–Aminophenyl)–1,1,1,3,3,3–hexafluoropropan–2–ol, 2-(3-Aminophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol, 95%, 95%, 2-(3-Aminophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
2-(3-aminophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol (CAS 2402-67-7) is a chemical compound with the molecular formula C9H7F6NO and a molecular weight of 259.15 g/mol. IUPAC name: 2-(3-aminophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol. InChIKey: LLDYYDVBNYAQJM-UHFFFAOYSA-N.
| Molecular formula | C9H7F6NO |
|---|---|
| Molecular weight | 259.15 g/mol |
| IUPAC name | 2-(3-aminophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
| InChIKey | LLDYYDVBNYAQJM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C(C(F)(F)F)(C(F)(F)F)O |
Computed by PubChem (NCBI)