CAS 41242-02-8 is the registry number for 2-(1,1,2,3,3,3-Hexafluoropropoxy)aniline, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-(1,1,2,3,3,3-hexafluoropropoxy)aniline (CAS 41242-02-8) is a chemical compound with the molecular formula C9H7F6NO and a molecular weight of 259.15 g/mol. IUPAC name: 2-(1,1,2,3,3,3-hexafluoropropoxy)aniline. InChIKey: MPTGLGDJRRTDLC-UHFFFAOYSA-N.
| Molecular formula | C9H7F6NO |
|---|---|
| Molecular weight | 259.15 g/mol |
| IUPAC name | 2-(1,1,2,3,3,3-hexafluoropropoxy)aniline |
| InChIKey | MPTGLGDJRRTDLC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)OC(C(C(F)(F)F)F)(F)F |
Computed by PubChem (NCBI)